4-(4-Chlorophenoxy)phenol
Catalog No: FT-0645194
CAS No: 21567-18-0
- Chemical Name: 4-(4-Chlorophenoxy)phenol
- Molecular Formula: C12H9ClO2
- Molecular Weight: 220.65
- InChI Key: XQMRZWSYBUCVAX-UHFFFAOYSA-N
- InChI: InChI=1S/C12H9ClO2/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,14H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 220.652 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 21567-18-0 |
| Bolling_Point: | 343.9±22.0 °C at 760 mmHg |
| Product_Name: | 4-(4-Chlorophenoxy)phenol |
| Melting_Point: | 80-85ºC |
| Flash_Point: | 161.8±22.3 °C |
| MF: | C12H9ClO2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 3.95 |
| Flash_Point: | 161.8±22.3 °C |
| Melting_Point: | 80-85ºC |
| FW: | 220.652 |
| PSA: | 29.46000 |
| Exact_Mass: | 220.029114 |
| MF: | C12H9ClO2 |
| Bolling_Point: | 343.9±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.615 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338-P342 + P311 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2909500000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)